CAS 173774-48-6 appears in our catalog under these names: (R)–1–N–Boc–4–N–Boc–Piperazine–2–Carboxylic Acid, (R)-1,4-Bis(tert-butoxycarbonyl)piperazine-2-carboxylic acid, 98%, 98%, (R)-1-N-Boc-4-N-Boc-Piperazine-2-carboxylic acid, 98%, (R)-1,4-Bis(tert-butoxycarbonyl)piperazine-2-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 25g, 5g, 100g, 500g.
(2R)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 173774-48-6) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: (2R)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: IIZGWFQKLVCLLA-SNVBAGLBSA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | (2R)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | IIZGWFQKLVCLLA-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)