CAS 1408074-53-2 is the registry number for 8-Boc-2,8-diaza-spiro[4.5]decane oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 1408074-53-2) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: GTKILXYGKZLXMM-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid |
| InChIKey | GTKILXYGKZLXMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC2)CC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)