Products 1408074-53-2

CAS 1408074-53-2 is the registry number for 8-Boc-2,8-diaza-spiro[4.5]decane oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 1408074-53-2) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: GTKILXYGKZLXMM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O6
Molecular weight330.38 g/mol
IUPAC nametert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid
InChIKeyGTKILXYGKZLXMM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCNC2)CC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)