Products 1706436-59-0

CAS 1706436-59-0 is the registry number for 2–Boc–2,7–diazaspiro(4·5)decane oxalate. Offered by: GLPBio. Available pack sizes: 1mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,9-diazaspiro[4.5]decane-2-carboxylate;oxalic acid (CAS 1706436-59-0) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 2,9-diazaspiro[4.5]decane-2-carboxylate;oxalic acid. InChIKey: FXIIOROVJSTREN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O6
Molecular weight330.38 g/mol
IUPAC nametert-butyl 2,9-diazaspiro[4.5]decane-2-carboxylate;oxalic acid
InChIKeyFXIIOROVJSTREN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CCCNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)