CAS 1706436-59-0 is the registry number for 2–Boc–2,7–diazaspiro(4·5)decane oxalate. Offered by: GLPBio. Available pack sizes: 1mg.
Tert-butyl 2,9-diazaspiro[4.5]decane-2-carboxylate;oxalic acid (CAS 1706436-59-0) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 2,9-diazaspiro[4.5]decane-2-carboxylate;oxalic acid. InChIKey: FXIIOROVJSTREN-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | tert-butyl 2,9-diazaspiro[4.5]decane-2-carboxylate;oxalic acid |
| InChIKey | FXIIOROVJSTREN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)