CAS 1188354-74-6 appears in our catalog under these names: 5-Fluoro-6-methoxy-2,3-dihydro-1H-indole-2,3-dione, 95%, 5-Fluoro-6-methoxy-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-fluoro-6-methoxy-1H-indole-2,3-dione (CAS 1188354-74-6) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 5-fluoro-6-methoxy-1H-indole-2,3-dione. InChIKey: QKNSRDZWCQCKQV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 5-fluoro-6-methoxy-1H-indole-2,3-dione |
| InChIKey | QKNSRDZWCQCKQV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=O)C2=O)F |
Computed by PubChem (NCBI)