Products 1189466-17-8
CAS 1189466-17-8 appears in our catalog under these names: Saccharin-d4 (ring-d4), 99 atom % D, min 98% Chemical Purity, Saccharin-d4, >95% (HPLC), Saccharin–d4, Saccharin-d4, Saccharin-d4, 99.71%. Offered by: CDN, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 1mg, 5mg, 1 mg.
4,5,6,7-tetradeuterio-1,1-dioxo-1,2-benzothiazol-3-one (CAS 1189466-17-8) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 187.21 g/mol. IUPAC name: 4,5,6,7-tetradeuterio-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: CVHZOJJKTDOEJC-RHQRLBAQSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 4,5,6,7-tetradeuterio-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | CVHZOJJKTDOEJC-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=O)NS2(=O)=O)[2H])[2H] |
Computed by PubChem (NCBI)