Products 71730-46-6
CAS 71730-46-6 appears in our catalog under these names: Benzo[e][1,2,3]oxathiazine 2,2-dioxide, 95%, Benzo(e)(1，2，3)oxathiazine 2，2–dioxide, Benzo[e][1，2，3]oxathiazine 2，2-dioxide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
1,2lambda6,3-benzoxathiazine 2,2-dioxide (CAS 71730-46-6) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. IUPAC name: 1,2lambda6,3-benzoxathiazine 2,2-dioxide. InChIKey: FURVSEVWPXHUEK-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 1,2lambda6,3-benzoxathiazine 2,2-dioxide |
| InChIKey | FURVSEVWPXHUEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NS(=O)(=O)O2 |
Computed by PubChem (NCBI)
Synonyms:
2H-1,2lambda~6~,3-Benzoxathiazine-2,2-dione, benzo[e][1,2,3]oxathiazine 2,2-dioxide, 1,2,3-Benzoxathiazine, 2,2-dioxide, 1,2lambda6,3-benzoxathiazine 2,2-dioxide, benzoxathiazine dioxide, FURVSEVWPXHUEK-UHFFFAOYSA-N, 2,2-dioxo-1,2,3-benzoxathiazine, Benzo[e][123]oxathiazine 22-dioxide, 1,2|E?,3-benzoxathiazine-2,2-dione, benzo[e][1,2,3]oxathiazine2,2-dioxide