CAS 2173565-54-1 is the registry number for Thieno[2,3-b]pyridin-3(2h)-one 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
1,1-dioxothieno[2,3-b]pyridin-3-one (CAS 2173565-54-1) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. IUPAC name: 1,1-dioxothieno[2,3-b]pyridin-3-one. InChIKey: PURUKMLQZGUQMY-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 1,1-dioxothieno[2,3-b]pyridin-3-one |
| InChIKey | PURUKMLQZGUQMY-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(S1(=O)=O)N=CC=C2 |
Computed by PubChem (NCBI)