CAS 1822981-28-1 is the registry number for 6-Amino-5-hydroxy-2H-1,3-benzoxathiol-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-amino-5-hydroxy-1,3-benzoxathiol-2-one (CAS 1822981-28-1) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. IUPAC name: 6-amino-5-hydroxy-1,3-benzoxathiol-2-one. InChIKey: CLBPUJRZHZQUCY-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 6-amino-5-hydroxy-1,3-benzoxathiol-2-one |
| InChIKey | CLBPUJRZHZQUCY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(=O)S2)O)N |
Computed by PubChem (NCBI)