CAS 2243521-55-1 is the registry number for 7-Methyl-1H,2H,4H-thieno(3,4-d)(1,3)oxazine-2,4-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-methyl-1H-thieno[3,4-d][1,3]oxazine-2,4-dione (CAS 2243521-55-1) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. IUPAC name: 7-methyl-1H-thieno[3,4-d][1,3]oxazine-2,4-dione. InChIKey: ARTKVKJIRADHJV-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 7-methyl-1H-thieno[3,4-d][1,3]oxazine-2,4-dione |
| InChIKey | ARTKVKJIRADHJV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CS1)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)