CAS 412950-59-5 is the registry number for 6-Methyl-2H-thieno[3,2-d][1,3]oxazine-2,4(1H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-1H-thieno[3,2-d][1,3]oxazine-2,4-dione (CAS 412950-59-5) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. IUPAC name: 6-methyl-1H-thieno[3,2-d][1,3]oxazine-2,4-dione. InChIKey: FDGABPBFMZUJGD-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 6-methyl-1H-thieno[3,2-d][1,3]oxazine-2,4-dione |
| InChIKey | FDGABPBFMZUJGD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)