CAS 2845-62-7 appears in our catalog under these names: Benzenesulfonyl isocyanate, 97%, Benzenesulfonyl isocyanate, Benzenesulfonyl Isocyanate, >97.0%(T), Benzenesulfonyl isocyanate 95%. Offered by: AmBeed, GLPBio, TCI. Available pack sizes: 250mg, 5g, 100g, 1g, 25g.
N-(oxomethylidene)benzenesulfonamide (CAS 2845-62-7) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. IUPAC name: N-(oxomethylidene)benzenesulfonamide. InChIKey: UJYAZVSPFMJCLW-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | N-(oxomethylidene)benzenesulfonamide |
| InChIKey | UJYAZVSPFMJCLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N=C=O |
Computed by PubChem (NCBI)