CAS 1286479-01-3 appears in our catalog under these names: Saccharin-13C6, 98% 98%atom%13C, Saccharin-13C6, Saccharin-13C6, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 0,5mg, 1mg, 2,5mg, 10mg, 5mg, 25mg, 50mg.
1,1-dioxo-1,2-benzothiazol-3-one (CAS 1286479-01-3) is a chemical compound with the molecular formula C7H5NO3S and a molecular weight of 189.14 g/mol. IUPAC name: 1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: CVHZOJJKTDOEJC-IDEBNGHGSA-N.
| Molecular formula | C7H5NO3S |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | CVHZOJJKTDOEJC-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]2[13C](=[13CH]1)C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)