Products 1189718-61-3
CAS 1189718-61-3 appears in our catalog under these names: 5-Amino-2-nitrobenzophenone-d5, 5–Amino–2–nitrobenzophenone–d5, 2-Amino-5-nitrobenzophenone-d5. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 10 mg, 100 mg.
(2-amino-5-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 1189718-61-3) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 247.26 g/mol. IUPAC name: (2-amino-5-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: PZPZDEIASIKHPY-RALIUCGRSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | (2-amino-5-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | PZPZDEIASIKHPY-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])N)[2H])[2H] |
Computed by PubChem (NCBI)