Products 1192263-98-1
CAS 1192263-98-1 appears in our catalog under these names: 2,3-Dichloroisonicotinamide, 95%, 2,3-Dichloroisonicotinamide, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g.
2,3-dichloropyridine-4-carboxamide (CAS 1192263-98-1) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 2,3-dichloropyridine-4-carboxamide. InChIKey: CTCWMPLLIMMSFC-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 2,3-dichloropyridine-4-carboxamide |
| InChIKey | CTCWMPLLIMMSFC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)