CAS 119308-57-5 appears in our catalog under these names: Methyl 2,6–dibromopyridine–4–carboxylate, Methyl 2,6-dibromoisonicotinate 96%, Methyl 2,6-dibromoisonicotinate, 98%, 98%, METHYL 2,6-DIBROMOPYRIDINE-4-CARBOXYLATE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 100g, 500g, 1kg, 10g.
Methyl 2,6-dibromopyridine-4-carboxylate (CAS 119308-57-5) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: methyl 2,6-dibromopyridine-4-carboxylate. InChIKey: XGHFPTMUVIDZNF-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | methyl 2,6-dibromopyridine-4-carboxylate |
| InChIKey | XGHFPTMUVIDZNF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)Br)Br |
Computed by PubChem (NCBI)