CAS 1193388-69-0 appears in our catalog under these names: 1-(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)ethan-1-amine hydrochloride, 95%, 1-(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethanamine;hydrochloride (CAS 1193388-69-0) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethanamine;hydrochloride. InChIKey: VYIUDZLVVLWZEY-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethanamine;hydrochloride |
| InChIKey | VYIUDZLVVLWZEY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1Br)OCCO2)N.Cl |
Computed by PubChem (NCBI)