CAS 1194655-80-5 is the registry number for 4,5,6,7-Tetrahydro-4,7-methanobenzo(b)thiophene-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxylic acid (CAS 1194655-80-5) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: 3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxylic acid. InChIKey: DWLMCBCPGLTBCX-UHFFFAOYSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | 3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxylic acid |
| InChIKey | DWLMCBCPGLTBCX-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3=C2SC(=C3)C(=O)O |
Computed by PubChem (NCBI)