CAS 42925-28-0 appears in our catalog under these names: 3-Phenyl-2,3-dihydrothiophene 1,1-dioxide, 95%, 3-Phenyl-2,3-dihydrothiophene 1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-phenyl-2,3-dihydrothiophene 1,1-dioxide (CAS 42925-28-0) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: 3-phenyl-2,3-dihydrothiophene 1,1-dioxide. InChIKey: GMEWRVSTRDCOQR-UHFFFAOYSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | 3-phenyl-2,3-dihydrothiophene 1,1-dioxide |
| InChIKey | GMEWRVSTRDCOQR-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)