Products 1369149-22-3

CAS 1369149-22-3 is the registry number for Isothiochromane-8-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3,4-dihydro-1H-isothiochromene-8-carboxylic acid (CAS 1369149-22-3) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: 3,4-dihydro-1H-isothiochromene-8-carboxylic acid. InChIKey: WHKLOQGGGVKVBP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O2S
Molecular weight194.25 g/mol
IUPAC name3,4-dihydro-1H-isothiochromene-8-carboxylic acid
InChIKeyWHKLOQGGGVKVBP-UHFFFAOYSA-N
SMILESC1CSCC2=C1C=CC=C2C(=O)O

Computed by PubChem (NCBI)