CAS 23994-65-2 appears in our catalog under these names: 5-Thien-2-ylcyclohexane-1,3-dione, 5-(2-Thienyl)cyclohexane-1,3-dione, 95%, 5-Thien-2-ylcyclohexane-1,3-dione, 98%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 2mg, 10mg, 5g, 250mg, 1g.
5-thiophen-2-ylcyclohexane-1,3-dione (CAS 23994-65-2) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: 5-thiophen-2-ylcyclohexane-1,3-dione. InChIKey: GABNRVGIJFLKAW-UHFFFAOYSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | 5-thiophen-2-ylcyclohexane-1,3-dione |
| InChIKey | GABNRVGIJFLKAW-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC=CS2 |
Computed by PubChem (NCBI)