CAS 26018-71-3 appears in our catalog under these names: 6-Methyl-2,3-dihydrobenzo(b)thiophene-2-carboxylic acid, 97%, 6-Methyl-2,3-dihydro-1-benzothiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
6-methyl-2,3-dihydro-1-benzothiophene-2-carboxylic acid (CAS 26018-71-3) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: 6-methyl-2,3-dihydro-1-benzothiophene-2-carboxylic acid. InChIKey: XTRJFBANXKEVBM-UHFFFAOYSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | 6-methyl-2,3-dihydro-1-benzothiophene-2-carboxylic acid |
| InChIKey | XTRJFBANXKEVBM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CC(S2)C(=O)O)C=C1 |
Computed by PubChem (NCBI)