CAS 912462-80-7 appears in our catalog under these names: (6-Methoxy-benzo[b]thiophen-2-yl)-methanol, 95%, (6-Methoxybenzo(b)thiophen-2-yl)methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,25g, 0,1g, 0,5g, 2g.
(6-methoxy-1-benzothiophen-2-yl)methanol (CAS 912462-80-7) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: (6-methoxy-1-benzothiophen-2-yl)methanol. InChIKey: JZUVUZMTYCJNDV-UHFFFAOYSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | (6-methoxy-1-benzothiophen-2-yl)methanol |
| InChIKey | JZUVUZMTYCJNDV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(S2)CO |
Computed by PubChem (NCBI)