CAS 2135442-60-1 is the registry number for rel-(1R,2S)-2-(Phenylthio)cyclopropane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1R,2S)-2-phenylsulfanylcyclopropane-1-carboxylic acid (CAS 2135442-60-1) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: trans-(1R,2S)-2-phenylsulfanylcyclopropane-1-carboxylic acid. InChIKey: CCYWYCFSZCKDIN-IUCAKERBSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | trans-(1R,2S)-2-phenylsulfanylcyclopropane-1-carboxylic acid |
| InChIKey | CCYWYCFSZCKDIN-IUCAKERBSA-N |
| SMILES | C1[C@@H]([C@H]1SC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)