CAS 102016-58-0 appears in our catalog under these names: 3-[4-(Methylsulfanyl)phenyl]acrylic acid, 95%, 3-(4-(Methylthio)phenyl)acrylic acid 98% (E), 3-(4-(Methylthio)phenyl)acrylic acid, 98% (E), 98% (E), 4-(Methylthio)cinnamic acid, 97%, 3-(4-(Methylthio)phenyl)acrylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
(E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid (CAS 102016-58-0) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: (E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid. InChIKey: AHBHKZCSIUIANZ-QPJJXVBHSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | (E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid |
| InChIKey | AHBHKZCSIUIANZ-QPJJXVBHSA-N |
| SMILES | CSC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)