CAS 1195164-50-1 is the registry number for rel-(4R,7S)-2-Hydroxy-3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindole-1,3(2H)-dione, 98%. Offered by: AmBeed. Available pack sizes: 25g.
(1R,7S)-4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 1195164-50-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: (1R,7S)-4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: ZUSSTQCWRDLYJA-DPTVFECHSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (1R,7S)-4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | ZUSSTQCWRDLYJA-DPTVFECHSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1C3C2C(=O)N(C3=O)O |
Computed by PubChem (NCBI)