CAS 21715-90-2 appears in our catalog under these names: N–Hydroxy–5–norbornene–2·3–dicarboxylic imide, HONB, endo-N-Hydroxy-5-norbornene-2,3-dicarboximide, 97% , N-Hydroxy-5-norbornene-2,3-dicarboximide [for Peptide Synthesis], >99.0%(T), N-Hydroxy-5-norbornene-2,3-dicarboximide 98%. Offered by: GLPBio, TRC, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 250g, 500g, 50g, 25g, 10g, 5g, 1000g.
4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 21715-90-2) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: ZUSSTQCWRDLYJA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | ZUSSTQCWRDLYJA-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)O |
Computed by PubChem (NCBI)