CAS 1195901-67-7 is the registry number for 4-Methoxycarbonylbenzamidine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Methyl 4-carbamimidoylbenzoate;dihydrochloride (CAS 1195901-67-7) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: methyl 4-carbamimidoylbenzoate;dihydrochloride. InChIKey: ONSWKOIBQHWCPA-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | methyl 4-carbamimidoylbenzoate;dihydrochloride |
| InChIKey | ONSWKOIBQHWCPA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)