CAS 1956319-58-6 appears in our catalog under these names: Ethyl 2-amino-2-(3-chloropyridin-4-yl)acetate hydrochloride, 97%, Ethyl 2–amino–2–(3–chloropyridin–4–yl)acetate hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 5g.
Ethyl 2-amino-2-(3-chloro-4-pyridinyl)acetate;hydrochloride (CAS 1956319-58-6) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: ethyl 2-amino-2-(3-chloro-4-pyridinyl)acetate;hydrochloride. InChIKey: DEUOKLCMASNIHH-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | ethyl 2-amino-2-(3-chloro-4-pyridinyl)acetate;hydrochloride |
| InChIKey | DEUOKLCMASNIHH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=NC=C1)Cl)N.Cl |
Computed by PubChem (NCBI)