CAS 1810074-86-2 appears in our catalog under these names: (S)–Methyl 2–amino–3–(5–chloropyridin–2–yl)propanoate hydrochloride, (S)-Methyl 2-amino-3-(5-chloropyridin-2-yl)propanoate hydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Methyl (2S)-2-amino-3-(5-chloro-2-pyridinyl)propanoate;hydrochloride (CAS 1810074-86-2) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: methyl (2S)-2-amino-3-(5-chloro-2-pyridinyl)propanoate;hydrochloride. InChIKey: QPKJLMVYNDVQNM-QRPNPIFTSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(5-chloro-2-pyridinyl)propanoate;hydrochloride |
| InChIKey | QPKJLMVYNDVQNM-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](CC1=NC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)