CAS 1706432-06-5 is the registry number for 5,6,7,8-Tetrahydro-1,6-naphthyridine-4-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6,7,8-tetrahydro-1,6-naphthyridine-4-carboxylic acid;dihydrochloride (CAS 1706432-06-5) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: 5,6,7,8-tetrahydro-1,6-naphthyridine-4-carboxylic acid;dihydrochloride. InChIKey: VWNFQEUBFUZJAP-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-1,6-naphthyridine-4-carboxylic acid;dihydrochloride |
| InChIKey | VWNFQEUBFUZJAP-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C(C=CN=C21)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)