CAS 2089277-85-8 is the registry number for Methyl 5H,6H,7H-pyrrolo(3,4-b)pyridine-2-carboxylate dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 6,7-dihydro-5H-pyrrolo[3,4-b]pyridine-2-carboxylate;dihydrochloride (CAS 2089277-85-8) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: methyl 6,7-dihydro-5H-pyrrolo[3,4-b]pyridine-2-carboxylate;dihydrochloride. InChIKey: HCPHVJODSIHWAT-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | methyl 6,7-dihydro-5H-pyrrolo[3,4-b]pyridine-2-carboxylate;dihydrochloride |
| InChIKey | HCPHVJODSIHWAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(CNC2)C=C1.Cl.Cl |
Computed by PubChem (NCBI)