Products 2287259-57-6

CAS 2287259-57-6 is the registry number for Methyl 2-amino-3-(6-chloropyridin-3-yl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-(6-chloro-3-pyridinyl)propanoate;hydrochloride (CAS 2287259-57-6) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: methyl 2-amino-3-(6-chloro-3-pyridinyl)propanoate;hydrochloride. InChIKey: RPVSDHGNNIFPLN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N2O2
Molecular weight251.11 g/mol
IUPAC namemethyl 2-amino-3-(6-chloro-3-pyridinyl)propanoate;hydrochloride
InChIKeyRPVSDHGNNIFPLN-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CN=C(C=C1)Cl)N.Cl

Computed by PubChem (NCBI)