CAS 2287259-57-6 is the registry number for Methyl 2-amino-3-(6-chloropyridin-3-yl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-3-(6-chloro-3-pyridinyl)propanoate;hydrochloride (CAS 2287259-57-6) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: methyl 2-amino-3-(6-chloro-3-pyridinyl)propanoate;hydrochloride. InChIKey: RPVSDHGNNIFPLN-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | methyl 2-amino-3-(6-chloro-3-pyridinyl)propanoate;hydrochloride |
| InChIKey | RPVSDHGNNIFPLN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CN=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)