CAS 2241138-76-9 is the registry number for 5-Amino-2,3-dihydro-1H-indole-2-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-2,3-dihydro-1H-indole-2-carboxylic acid;dihydrochloride (CAS 2241138-76-9) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: 5-amino-2,3-dihydro-1H-indole-2-carboxylic acid;dihydrochloride. InChIKey: CLCNRHCCSKRWOV-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 5-amino-2,3-dihydro-1H-indole-2-carboxylic acid;dihydrochloride |
| InChIKey | CLCNRHCCSKRWOV-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=C(C=C2)N)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)