Products 2241138-76-9

CAS 2241138-76-9 is the registry number for 5-Amino-2,3-dihydro-1H-indole-2-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-amino-2,3-dihydro-1H-indole-2-carboxylic acid;dihydrochloride (CAS 2241138-76-9) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: 5-amino-2,3-dihydro-1H-indole-2-carboxylic acid;dihydrochloride. InChIKey: CLCNRHCCSKRWOV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N2O2
Molecular weight251.11 g/mol
IUPAC name5-amino-2,3-dihydro-1H-indole-2-carboxylic acid;dihydrochloride
InChIKeyCLCNRHCCSKRWOV-UHFFFAOYSA-N
SMILESC1C(NC2=C1C=C(C=C2)N)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)