Products 1956332-71-0

CAS 1956332-71-0 is the registry number for Ethyl 2-(5-chloropyridin-2-ylamino)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(5-chloro-2-pyridinyl)amino]acetate;hydrochloride (CAS 1956332-71-0) is a chemical compound with the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. IUPAC name: ethyl 2-[(5-chloro-2-pyridinyl)amino]acetate;hydrochloride. InChIKey: KZNIRDNPJNQRGG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N2O2
Molecular weight251.11 g/mol
IUPAC nameethyl 2-[(5-chloro-2-pyridinyl)amino]acetate;hydrochloride
InChIKeyKZNIRDNPJNQRGG-UHFFFAOYSA-N
SMILESCCOC(=O)CNC1=NC=C(C=C1)Cl.Cl

Computed by PubChem (NCBI)