Products 1196155-86-8
CAS 1196155-86-8 appears in our catalog under these names: 6-(trifluoromethyl)furo[2,3-b]pyridin-3-one, 97%, 97%, 6-(trifluoromethyl)furo[2,3-b]pyridin-3-ol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-(trifluoromethyl)furo[2,3-b]pyridin-3-one (CAS 1196155-86-8) is a chemical compound with the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. IUPAC name: 6-(trifluoromethyl)furo[2,3-b]pyridin-3-one. InChIKey: IIHNLSZJYWGRFE-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO2 |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 6-(trifluoromethyl)furo[2,3-b]pyridin-3-one |
| InChIKey | IIHNLSZJYWGRFE-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)N=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)