CAS 120079-81-4 is the registry number for 3-(Prop-2-en-1-yl)-2-sulfanyl-3H,4H-thieno(3,2-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-prop-2-enyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (CAS 120079-81-4) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 3-prop-2-enyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one. InChIKey: IGFHWSNDYCOUBD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 3-prop-2-enyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | IGFHWSNDYCOUBD-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)C2=C(C=CS2)NC1=S |
Computed by PubChem (NCBI)