CAS 849066-64-4 is the registry number for 1-(2'-Methyl-[2,4'-bithiazol]-4-yl)ethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]ethanone (CAS 849066-64-4) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]ethanone. InChIKey: DYZFPIQKTUEXNE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]ethanone |
| InChIKey | DYZFPIQKTUEXNE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=NC(=CS2)C(=O)C |
Computed by PubChem (NCBI)