CAS 51550-04-0 appears in our catalog under these names: 3-Allyl-2-mercaptothieno[2,3-d]pyrimidin-4(3h)-one, 95%, 3-Allyl-2-mercaptothieno(2,3-d)pyrimidin-4(3H)-one, 97% +(stabilized with TBC), 3-(Prop-2-en-1-yl)-2-sulfanyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-prop-2-enyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 51550-04-0) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 3-prop-2-enyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: CBGGZFBMKNURDF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 3-prop-2-enyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | CBGGZFBMKNURDF-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)C2=C(NC1=S)SC=C2 |
Computed by PubChem (NCBI)