CAS 926195-39-3 is the registry number for 3-Cyclopropyl-2-thioxo-2,3-dihydrothieno[3,2-d]pyrimidin-4(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (CAS 926195-39-3) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 3-cyclopropyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one. InChIKey: UZENOPDNPICWGT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 3-cyclopropyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | UZENOPDNPICWGT-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=O)C3=C(C=CS3)NC2=S |
Computed by PubChem (NCBI)