CAS 400080-72-0 appears in our catalog under these names: N–Methyl–2–(thiophen–2–yl)–1,3–thiazole–4–carboxamide, N-Methyl-2-(thiophen-2-yl)-1,3-thiazole-4-carboxamide 90%, N-Methyl-2-(thiophen-2-yl)-1,3-thiazole-4-carboxamide, 90%, 90%, N-Methyl-2-(thiophen-2-yl)-1,3-thiazole-4-carboxamide, 90%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-methyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (CAS 400080-72-0) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: N-methyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide. InChIKey: VFANSSLFXLATKG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | N-methyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| InChIKey | VFANSSLFXLATKG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CSC(=N1)C2=CC=CS2 |
Computed by PubChem (NCBI)