CAS 353772-94-8 appears in our catalog under these names: 5'-Amino-2,3'-bithiophene-4'-carboxamide, 95%, 2-Amino-4-(thiophen-2-yl)thiophene-3-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
2-amino-4-thiophen-2-ylthiophene-3-carboxamide (CAS 353772-94-8) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 2-amino-4-thiophen-2-ylthiophene-3-carboxamide. InChIKey: AOKUOQRFZXRQBM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 2-amino-4-thiophen-2-ylthiophene-3-carboxamide |
| InChIKey | AOKUOQRFZXRQBM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CSC(=C2C(=O)N)N |
Computed by PubChem (NCBI)