CAS 51216-58-1 is the registry number for 3-(Pyridin-3-ylmethyl)-2-thioxothiazolidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 51216-58-1) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: HVOPSRSIFJPCRF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | HVOPSRSIFJPCRF-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)S1)CC2=CN=CC=C2 |
Computed by PubChem (NCBI)