CAS 13097-10-4 appears in our catalog under these names: 3-(Phenylamino)-2-thioxothiazolidin-4-one, 95+%, 3-Anilino-2-thioxo-1,3-thiazolidin-4-one, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
3-anilino-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 13097-10-4) is a chemical compound with the molecular formula C9H8N2OS2 and a molecular weight of 224.3 g/mol. IUPAC name: 3-anilino-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: SNRGCDPTDOAQEQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 3-anilino-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | SNRGCDPTDOAQEQ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)S1)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)