Products 1203662-77-4

CAS 1203662-77-4 is the registry number for 2,4-Difluoro-3-formylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,4-difluoro-3-formylbenzoic acid (CAS 1203662-77-4) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 2,4-difluoro-3-formylbenzoic acid. InChIKey: QYBCFUZTCWGXAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F2O3
Molecular weight186.11 g/mol
IUPAC name2,4-difluoro-3-formylbenzoic acid
InChIKeyQYBCFUZTCWGXAJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)F)C=O)F

Computed by PubChem (NCBI)