CAS 1205638-72-7 is the registry number for 3,4-Difluorobenzimidic acid ethyl ester hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 3,4-difluorobenzenecarboximidate;hydrochloride (CAS 1205638-72-7) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: ethyl 3,4-difluorobenzenecarboximidate;hydrochloride. InChIKey: MGQCRMMABCPLJL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | ethyl 3,4-difluorobenzenecarboximidate;hydrochloride |
| InChIKey | MGQCRMMABCPLJL-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C1=CC(=C(C=C1)F)F.Cl |
Computed by PubChem (NCBI)