Products 1205638-72-7

CAS 1205638-72-7 is the registry number for 3,4-Difluorobenzimidic acid ethyl ester hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Ethyl 3,4-difluorobenzenecarboximidate;hydrochloride (CAS 1205638-72-7) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: ethyl 3,4-difluorobenzenecarboximidate;hydrochloride. InChIKey: MGQCRMMABCPLJL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClF2NO
Molecular weight221.63 g/mol
IUPAC nameethyl 3,4-difluorobenzenecarboximidate;hydrochloride
InChIKeyMGQCRMMABCPLJL-UHFFFAOYSA-N
SMILESCCOC(=N)C1=CC(=C(C=C1)F)F.Cl

Computed by PubChem (NCBI)