Products 1864062-13-4
CAS 1864062-13-4 is the registry number for 3-(3,5-Difluoro-phenoxy)-azetidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(3,5-difluorophenoxy)azetidine;hydrochloride (CAS 1864062-13-4) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 3-(3,5-difluorophenoxy)azetidine;hydrochloride. InChIKey: DYZARWVJCDJAHX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 3-(3,5-difluorophenoxy)azetidine;hydrochloride |
| InChIKey | DYZARWVJCDJAHX-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)