Products 2306275-02-3
CAS 2306275-02-3 appears in our catalog under these names: 3-(2,6-Difluorophenyl)azetidin-3-ol hydrochloride, 95%, 3-(2,6-Difluorophenyl)azetidin-3-ol hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 500mg.
3-(2,6-difluorophenyl)azetidin-3-ol;hydrochloride (CAS 2306275-02-3) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 3-(2,6-difluorophenyl)azetidin-3-ol;hydrochloride. InChIKey: HKGICVKAFGPGOL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)azetidin-3-ol;hydrochloride |
| InChIKey | HKGICVKAFGPGOL-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=C(C=CC=C2F)F)O.Cl |
Computed by PubChem (NCBI)