CAS 1810070-13-3 appears in our catalog under these names: 5,8-Difluorochroman-4-amine hydrochloride, 95%, 5,8–Difluorochroman–4–amine hydrochloride, 5,8-Difluorochroman-4-amine hydrochloride, 95%, 95%, 5,8-Difluorochroman-4-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
5,8-difluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1810070-13-3) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 5,8-difluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: NTWBGVNPHSHJNN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 5,8-difluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | NTWBGVNPHSHJNN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2C1N)F)F.Cl |
Computed by PubChem (NCBI)