Products 2306276-63-9
CAS 2306276-63-9 is the registry number for 3-(2,4-Difluorophenyl)azetidin-3-ol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-difluorophenyl)azetidin-3-ol;hydrochloride (CAS 2306276-63-9) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 3-(2,4-difluorophenyl)azetidin-3-ol;hydrochloride. InChIKey: WUMNLDSTOVYOFJ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)azetidin-3-ol;hydrochloride |
| InChIKey | WUMNLDSTOVYOFJ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=C(C=C(C=C2)F)F)O.Cl |
Computed by PubChem (NCBI)