CAS 1807938-54-0 appears in our catalog under these names: (4R)-5,8-Difluoro-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride, 95%, (4R)-5,8-Difluoro-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1807938-54-0) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: (4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: NTWBGVNPHSHJNN-OGFXRTJISA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | (4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | NTWBGVNPHSHJNN-OGFXRTJISA-N |
| SMILES | C1COC2=C(C=CC(=C2[C@@H]1N)F)F.Cl |
Computed by PubChem (NCBI)